C10H14N2O2 — CID 19857501
methyl N-(3-amino-2,6-dimethylphenyl)carbamate (PubChem CID 19857501) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is methyl N-(3-amino-2,6-dimethylphenyl)carbamate.
| Compound Name | methyl N-(3-amino-2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 19857501 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | methyl N-(3-amino-2,6-dimethylphenyl)carbamate |
| SMILES | COC(=O)Nc1c(C)ccc(N)c1C |
| InChI | InChI=1S/C10H14N2O2/c1-6-4-5-8(11)7(2)9(6)12-10(13)14-3/h4-5H,11H2,1-3H3,(H,12,13) |
| InChIKey | MNZVCDXRIBHRON-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|