C12H19N3O — CID 28785713
1-(3-amino-2,6-dimethylphenyl)-3-propylurea (PubChem CID 28785713) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(3-amino-2,6-dimethylphenyl)-3-propylurea.
| Compound Name | 1-(3-amino-2,6-dimethylphenyl)-3-propylurea |
|---|---|
| PubChem CID | 28785713 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 1-(3-amino-2,6-dimethylphenyl)-3-propylurea |
| SMILES | CCCNC(=O)Nc1c(C)ccc(N)c1C |
| InChI | InChI=1S/C12H19N3O/c1-4-7-14-12(16)15-11-8(2)5-6-10(13)9(11)3/h5-6H,4,7,13H2,1-3H3,(H2,14,15,16) |
| InChIKey | QRASKJRPASEPKS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|