C11H10F7NS — CID 152616841
2-amino-3-ethyl-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzenethiol (PubChem CID 152616841) has the molecular formula C11H10F7NS and a molecular weight of 321.26 g/mol. Its IUPAC name is 2-amino-3-ethyl-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzenethiol.
| Compound Name | 2-amino-3-ethyl-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzenethiol |
|---|---|
| PubChem CID | 152616841 |
| Molecular Formula | C11H10F7NS |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 2-amino-3-ethyl-5-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzenethiol |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(S)c1N |
| InChI | InChI=1S/C11H10F7NS/c1-2-5-3-6(4-7(20)8(5)19)9(12,10(13,14)15)11(16,17)18/h3-4,20H,2,19H2,1H3 |
| InChIKey | ZARNMBWKUTTYDO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|