C22H22F7NO — CID 160723914
1-[4-(1-aminoethyl)phenyl]-2-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]ethanone (PubChem CID 160723914) has the molecular formula C22H22F7NO and a molecular weight of 449.41 g/mol. Its IUPAC name is 1-[4-(1-aminoethyl)phenyl]-2-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]ethanone.
| Compound Name | 1-[4-(1-aminoethyl)phenyl]-2-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]ethanone |
|---|---|
| PubChem CID | 160723914 |
| Molecular Formula | C22H22F7NO |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 1-[4-(1-aminoethyl)phenyl]-2-[2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-methylphenyl]ethanone |
| SMILES | CCc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1CC(=O)c1ccc(C(C)N)cc1 |
| InChI | InChI=1S/C22H22F7NO/c1-4-14-10-17(20(23,21(24,25)26)22(27,28)29)9-12(2)18(14)11-19(31)16-7-5-15(6-8-16)13(3)30/h5-10,13H,4,11,30H2,1-3H3 |
| InChIKey | ACLSYTFYNDKEEU-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |