C23H15F7N2O — CID 158397471
6-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]acetyl]quinoline-2-carbonitrile (PubChem CID 158397471) has the molecular formula C23H15F7N2O and a molecular weight of 468.37 g/mol. Its IUPAC name is 6-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]acetyl]quinoline-2-carbonitrile.
| Compound Name | 6-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]acetyl]quinoline-2-carbonitrile |
|---|---|
| PubChem CID | 158397471 |
| Molecular Formula | C23H15F7N2O |
| Molecular Weight | 468.37 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 6-[2-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]acetyl]quinoline-2-carbonitrile |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1CC(=O)c1ccc2nc(C#N)ccc2c1 |
| InChI | InChI=1S/C23H15F7N2O/c1-12-7-16(21(24,22(25,26)27)23(28,29)30)8-13(2)18(12)10-20(33)15-4-6-19-14(9-15)3-5-17(11-31)32-19/h3-9H,10H2,1-2H3 |
| InChIKey | KKHHYSJMHXVKQV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.37 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |