C17H17FO — CID 62549306
1-(4-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanone (PubChem CID 62549306) has the molecular formula C17H17FO and a molecular weight of 256.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 62549306 |
| Molecular Formula | C17H17FO |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(4-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(CC(=O)c2ccc(F)cc2)c(C)c1 |
| InChI | InChI=1S/C17H17FO/c1-11-8-12(2)16(13(3)9-11)10-17(19)14-4-6-15(18)7-5-14/h4-9H,10H2,1-3H3 |
| InChIKey | FHGMQIZEVARNQG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |