C23H29NO2 — CID 101424780
N-[(2S)-3-methylbutan-2-yl]-4-[2-(2,4,6-trimethylphenyl)acetyl]benzamide (PubChem CID 101424780) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-[(2S)-3-methylbutan-2-yl]-4-[2-(2,4,6-trimethylphenyl)acetyl]benzamide.
| Compound Name | N-[(2S)-3-methylbutan-2-yl]-4-[2-(2,4,6-trimethylphenyl)acetyl]benzamide |
|---|---|
| PubChem CID | 101424780 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-[(2S)-3-methylbutan-2-yl]-4-[2-(2,4,6-trimethylphenyl)acetyl]benzamide |
| SMILES | Cc1cc(C)c(CC(=O)c2ccc(C(=O)N[C@@H](C)C(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C23H29NO2/c1-14(2)18(6)24-23(26)20-9-7-19(8-10-20)22(25)13-21-16(4)11-15(3)12-17(21)5/h7-12,14,18H,13H2,1-6H3,(H,24,26)/t18-/m0/s1 |
| InChIKey | QPKLIZPFYRLADX-SFHVURJKSA-N |
| XLogP | 4.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |