C17H18FNO — CID 116597713
1-(2-amino-3-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanone (PubChem CID 116597713) has the molecular formula C17H18FNO and a molecular weight of 271.33 g/mol. Its IUPAC name is 1-(2-amino-3-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 1-(2-amino-3-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 116597713 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-(2-amino-3-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(CC(=O)c2cccc(F)c2N)c(C)c1 |
| InChI | InChI=1S/C17H18FNO/c1-10-7-11(2)14(12(3)8-10)9-16(20)13-5-4-6-15(18)17(13)19/h4-8H,9,19H2,1-3H3 |
| InChIKey | NORFTEXKJXAVBJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|