C16H15FO — CID 54958156
2-(2,5-dimethylphenyl)-1-(4-fluorophenyl)ethanone (PubChem CID 54958156) has the molecular formula C16H15FO and a molecular weight of 242.29 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-(2,5-dimethylphenyl)-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 54958156 |
| Molecular Formula | C16H15FO |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1-(4-fluorophenyl)ethanone |
| SMILES | Cc1ccc(C)c(CC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H15FO/c1-11-3-4-12(2)14(9-11)10-16(18)13-5-7-15(17)8-6-13/h3-9H,10H2,1-2H3 |
| InChIKey | BSZRZWMCYSKKPN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |