C16H14FIO — CID 114029336
2-(2,5-dimethylphenyl)-1-(4-fluoro-2-iodophenyl)ethanone (PubChem CID 114029336) has the molecular formula C16H14FIO and a molecular weight of 368.19 g/mol. Its IUPAC name is 2-(2,5-dimethylphenyl)-1-(4-fluoro-2-iodophenyl)ethanone.
| Compound Name | 2-(2,5-dimethylphenyl)-1-(4-fluoro-2-iodophenyl)ethanone |
|---|---|
| PubChem CID | 114029336 |
| Molecular Formula | C16H14FIO |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 2-(2,5-dimethylphenyl)-1-(4-fluoro-2-iodophenyl)ethanone |
| SMILES | Cc1ccc(C)c(CC(=O)c2ccc(F)cc2I)c1 |
| InChI | InChI=1S/C16H14FIO/c1-10-3-4-11(2)12(7-10)8-16(19)14-6-5-13(17)9-15(14)18/h3-7,9H,8H2,1-2H3 |
| InChIKey | RBVUBJYEYBVVGN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|