C15H15FIN — CID 79768890
N-[(2,5-dimethylphenyl)methyl]-4-fluoro-2-iodoaniline (PubChem CID 79768890) has the molecular formula C15H15FIN and a molecular weight of 355.19 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]-4-fluoro-2-iodoaniline.
| Compound Name | N-[(2,5-dimethylphenyl)methyl]-4-fluoro-2-iodoaniline |
|---|---|
| PubChem CID | 79768890 |
| Molecular Formula | C15H15FIN |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-[(2,5-dimethylphenyl)methyl]-4-fluoro-2-iodoaniline |
| SMILES | Cc1ccc(C)c(CNc2ccc(F)cc2I)c1 |
| InChI | InChI=1S/C15H15FIN/c1-10-3-4-11(2)12(7-10)9-18-15-6-5-13(16)8-14(15)17/h3-8,18H,9H2,1-2H3 |
| InChIKey | DZUVCVGBQLDXJV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|