C15H14BrFINO2 — CID 79759188
N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-fluoro-2-iodoaniline (PubChem CID 79759188) has the molecular formula C15H14BrFINO2 and a molecular weight of 466.09 g/mol. Its IUPAC name is N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-fluoro-2-iodoaniline.
| Compound Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-fluoro-2-iodoaniline |
|---|---|
| PubChem CID | 79759188 |
| Molecular Formula | C15H14BrFINO2 |
| Molecular Weight | 466.09 g/mol |
| Exact Mass | 464.92 |
| IUPAC Name | N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-4-fluoro-2-iodoaniline |
| SMILES | COc1cc(Br)c(CNc2ccc(F)cc2I)cc1OC |
| InChI | InChI=1S/C15H14BrFINO2/c1-20-14-5-9(11(16)7-15(14)21-2)8-19-13-4-3-10(17)6-12(13)18/h3-7,19H,8H2,1-2H3 |
| InChIKey | UJXFIVMPWCIXHK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.09 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|