C11H11FIN3 — CID 79768914
4-fluoro-2-iodo-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline (PubChem CID 79768914) has the molecular formula C11H11FIN3 and a molecular weight of 331.13 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline.
| Compound Name | 4-fluoro-2-iodo-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 79768914 |
| Molecular Formula | C11H11FIN3 |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 4-fluoro-2-iodo-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline |
| SMILES | Cc1[nH]ncc1CNc1ccc(F)cc1I |
| InChI | InChI=1S/C11H11FIN3/c1-7-8(6-15-16-7)5-14-11-3-2-9(12)4-10(11)13/h2-4,6,14H,5H2,1H3,(H,15,16) |
| InChIKey | XJGKFYQSNHNEKJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|