C12H14FN3O2S — CID 43717698
2-fluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-methylsulfonylaniline (PubChem CID 43717698) has the molecular formula C12H14FN3O2S and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-fluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-methylsulfonylaniline.
| Compound Name | 2-fluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-methylsulfonylaniline |
|---|---|
| PubChem CID | 43717698 |
| Molecular Formula | C12H14FN3O2S |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-fluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]-5-methylsulfonylaniline |
| SMILES | Cc1[nH]ncc1CNc1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C12H14FN3O2S/c1-8-9(7-15-16-8)6-14-12-5-10(19(2,17)18)3-4-11(12)13/h3-5,7,14H,6H2,1-2H3,(H,15,16) |
| InChIKey | HRZJMTXOZIVYQF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |