C11H11BrFN3 — CID 115909467
3-bromo-4-fluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline (PubChem CID 115909467) has the molecular formula C11H11BrFN3 and a molecular weight of 284.13 g/mol. Its IUPAC name is 3-bromo-4-fluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline.
| Compound Name | 3-bromo-4-fluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 115909467 |
| Molecular Formula | C11H11BrFN3 |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-bromo-4-fluoro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline |
| SMILES | Cc1[nH]ncc1CNc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrFN3/c1-7-8(6-15-16-7)5-14-9-2-3-11(13)10(12)4-9/h2-4,6,14H,5H2,1H3,(H,15,16) |
| InChIKey | XLWDXGZYAMGMFP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |