C12H12ClF2N3O — CID 43663580
3-chloro-4-(difluoromethoxy)-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline (PubChem CID 43663580) has the molecular formula C12H12ClF2N3O and a molecular weight of 287.70 g/mol. Its IUPAC name is 3-chloro-4-(difluoromethoxy)-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline.
| Compound Name | 3-chloro-4-(difluoromethoxy)-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 43663580 |
| Molecular Formula | C12H12ClF2N3O |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 3-chloro-4-(difluoromethoxy)-N-[(5-methyl-1H-pyrazol-4-yl)methyl]aniline |
| SMILES | Cc1[nH]ncc1CNc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H12ClF2N3O/c1-7-8(6-17-18-7)5-16-9-2-3-11(10(13)4-9)19-12(14)15/h2-4,6,12,16H,5H2,1H3,(H,17,18) |
| InChIKey | KOUCVOIJJCGCLB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|