C14H16FIN2 — CID 79769306
4-fluoro-2-iodo-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline (PubChem CID 79769306) has the molecular formula C14H16FIN2 and a molecular weight of 358.20 g/mol. Its IUPAC name is 4-fluoro-2-iodo-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline.
| Compound Name | 4-fluoro-2-iodo-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 79769306 |
| Molecular Formula | C14H16FIN2 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | 4-fluoro-2-iodo-N-[(1,2,5-trimethylpyrrol-3-yl)methyl]aniline |
| SMILES | Cc1cc(CNc2ccc(F)cc2I)c(C)n1C |
| InChI | InChI=1S/C14H16FIN2/c1-9-6-11(10(2)18(9)3)8-17-14-5-4-12(15)7-13(14)16/h4-7,17H,8H2,1-3H3 |
| InChIKey | JXZHRPFAZRGRGR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|