C16H14ClIO — CID 114029871
1-(5-chloro-2-iodophenyl)-2-(2,5-dimethylphenyl)ethanone (PubChem CID 114029871) has the molecular formula C16H14ClIO and a molecular weight of 384.64 g/mol. Its IUPAC name is 1-(5-chloro-2-iodophenyl)-2-(2,5-dimethylphenyl)ethanone.
| Compound Name | 1-(5-chloro-2-iodophenyl)-2-(2,5-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 114029871 |
| Molecular Formula | C16H14ClIO |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 1-(5-chloro-2-iodophenyl)-2-(2,5-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(C)c(CC(=O)c2cc(Cl)ccc2I)c1 |
| InChI | InChI=1S/C16H14ClIO/c1-10-3-4-11(2)12(7-10)8-16(19)14-9-13(17)5-6-15(14)18/h3-7,9H,8H2,1-2H3 |
| InChIKey | WWVXBPHCMDOAEG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|