C19H29F4N — CID 22638279
N-ethyl-N-(5-ethyl-2-methyloctyl)-2,3,4,5-tetrafluoroaniline (PubChem CID 22638279) has the molecular formula C19H29F4N and a molecular weight of 347.44 g/mol. Its IUPAC name is N-ethyl-N-(5-ethyl-2-methyloctyl)-2,3,4,5-tetrafluoroaniline.
| Compound Name | N-ethyl-N-(5-ethyl-2-methyloctyl)-2,3,4,5-tetrafluoroaniline |
|---|---|
| PubChem CID | 22638279 |
| Molecular Formula | C19H29F4N |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N-ethyl-N-(5-ethyl-2-methyloctyl)-2,3,4,5-tetrafluoroaniline |
| SMILES | CCCC(CC)CCC(C)CN(CC)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H29F4N/c1-5-8-14(6-2)10-9-13(4)12-24(7-3)16-11-15(20)17(21)19(23)18(16)22/h11,13-14H,5-10,12H2,1-4H3 |
| InChIKey | PEFUFDUQERERTN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|