C13H21FN2 — CID 79477918
2-N-ethyl-4-fluoro-2-N-(2-methylbutyl)benzene-1,2-diamine (PubChem CID 79477918) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 2-N-ethyl-4-fluoro-2-N-(2-methylbutyl)benzene-1,2-diamine.
| Compound Name | 2-N-ethyl-4-fluoro-2-N-(2-methylbutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 79477918 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 2-N-ethyl-4-fluoro-2-N-(2-methylbutyl)benzene-1,2-diamine |
| SMILES | CCC(C)CN(CC)c1cc(F)ccc1N |
| InChI | InChI=1S/C13H21FN2/c1-4-10(3)9-16(5-2)13-8-11(14)6-7-12(13)15/h6-8,10H,4-5,9,15H2,1-3H3 |
| InChIKey | GUYCCPVBVWJVPL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|