C14H21F2N — CID 22638194
N-ethyl-2,5-difluoro-N-(2-methylpentyl)aniline (PubChem CID 22638194) has the molecular formula C14H21F2N and a molecular weight of 241.32 g/mol. Its IUPAC name is N-ethyl-2,5-difluoro-N-(2-methylpentyl)aniline.
| Compound Name | N-ethyl-2,5-difluoro-N-(2-methylpentyl)aniline |
|---|---|
| PubChem CID | 22638194 |
| Molecular Formula | C14H21F2N |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-ethyl-2,5-difluoro-N-(2-methylpentyl)aniline |
| SMILES | CCCC(C)CN(CC)c1cc(F)ccc1F |
| InChI | InChI=1S/C14H21F2N/c1-4-6-11(3)10-17(5-2)14-9-12(15)7-8-13(14)16/h7-9,11H,4-6,10H2,1-3H3 |
| InChIKey | DNJHQDLSEPLRAW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |