C14H22F2N2 — CID 79478202
2-(difluoromethyl)-1-N-ethyl-1-N-(2-methylbutyl)benzene-1,4-diamine (PubChem CID 79478202) has the molecular formula C14H22F2N2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-ethyl-1-N-(2-methylbutyl)benzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-ethyl-1-N-(2-methylbutyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 79478202 |
| Molecular Formula | C14H22F2N2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 2-(difluoromethyl)-1-N-ethyl-1-N-(2-methylbutyl)benzene-1,4-diamine |
| SMILES | CCC(C)CN(CC)c1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C14H22F2N2/c1-4-10(3)9-18(5-2)13-7-6-11(17)8-12(13)14(15)16/h6-8,10,14H,4-5,9,17H2,1-3H3 |
| InChIKey | LSACJAPBLJWIPG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|