C19H32F2P+ — CID 23123032
(2,4-difluorophenyl)-ethyl-(5-ethyl-2-methyloctyl)phosphanium (PubChem CID 23123032) has the molecular formula C19H32F2P+ and a molecular weight of 329.44 g/mol. Its IUPAC name is (2,4-difluorophenyl)-ethyl-(5-ethyl-2-methyloctyl)phosphanium.
| Compound Name | (2,4-difluorophenyl)-ethyl-(5-ethyl-2-methyloctyl)phosphanium |
|---|---|
| PubChem CID | 23123032 |
| Molecular Formula | C19H32F2P+ |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | (2,4-difluorophenyl)-ethyl-(5-ethyl-2-methyloctyl)phosphanium |
| SMILES | CCCC(CC)CCC(C)C[PH+](CC)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H31F2P/c1-5-8-16(6-2)10-9-15(4)14-22(7-3)19-12-11-17(20)13-18(19)21/h11-13,15-16H,5-10,14H2,1-4H3/p+1 |
| InChIKey | RQJOHAGZVIAUKT-UHFFFAOYSA-O |
| XLogP | 6.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|