C62H122BF2P — CID 22637796
(2,5-difluorophenyl)-(3-ethylheptyl)-propylphosphanium;tetrakis(5-ethyl-2-methyloctyl)boranuide (PubChem CID 22637796) has the molecular formula C62H122BF2P and a molecular weight of 947.44 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(3-ethylheptyl)-propylphosphanium;tetrakis(5-ethyl-2-methyloctyl)boranuide.
| Compound Name | (2,5-difluorophenyl)-(3-ethylheptyl)-propylphosphanium;tetrakis(5-ethyl-2-methyloctyl)boranuide |
|---|---|
| PubChem CID | 22637796 |
| Molecular Formula | C62H122BF2P |
| Molecular Weight | 947.44 g/mol |
| Exact Mass | 946.93 |
| IUPAC Name | (2,5-difluorophenyl)-(3-ethylheptyl)-propylphosphanium;tetrakis(5-ethyl-2-methyloctyl)boranuide |
| SMILES | CCCC(CC)CCC(C)C[B-](CC(C)CCC(CC)CCC)(CC(C)CCC(CC)CCC)CC(C)CCC(CC)CCC.CCCCC(CC)CC[PH+](CCC)c1cc(F)ccc1F |
| InChI | InChI=1S/C44H92B.C18H29F2P/c1-13-21-41(17-5)29-25-37(9)33-45(34-38(10)26-30-42(18-6)22-14-2,35-39(11)27-31-43(19-7)23-15-3)36-40(12)28-32-44(20-8)24-16-4;1-4-7-8-15(6-3)11-13-21(12-5-2)18-14-16(19)9-10-17(18)20/h37-44H,13-36H2,1-12H3;9-10,14-15H,4-8,11-13H2,1-3H3/q-1;/p+1 |
| InChIKey | ZUEDCLAHXVRZQV-UHFFFAOYSA-O |
| XLogP | 22.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 42 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.44 |
| LogP ≤ 5 | 22.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|