C58H109AlF7P — CID 22637937
(2,5-difluorophenyl)-(2-methylpentyl)-(1,1,2,2,2-pentafluoroethyl)phosphanium;tetrakis(5-ethyl-2-methyloctyl)alumanuide (PubChem CID 22637937) has the molecular formula C58H109AlF7P and a molecular weight of 997.45 g/mol. Its IUPAC name is (2,5-difluorophenyl)-(2-methylpentyl)-(1,1,2,2,2-pentafluoroethyl)phosphanium;tetrakis(5-ethyl-2-methyloctyl)alumanuide.
| Compound Name | (2,5-difluorophenyl)-(2-methylpentyl)-(1,1,2,2,2-pentafluoroethyl)phosphanium;tetrakis(5-ethyl-2-methyloctyl)alumanuide |
|---|---|
| PubChem CID | 22637937 |
| Molecular Formula | C58H109AlF7P |
| Molecular Weight | 997.45 g/mol |
| Exact Mass | 996.80 |
| IUPAC Name | (2,5-difluorophenyl)-(2-methylpentyl)-(1,1,2,2,2-pentafluoroethyl)phosphanium;tetrakis(5-ethyl-2-methyloctyl)alumanuide |
| SMILES | CCCC(C)C[PH+](c1cc(F)ccc1F)C(F)(F)C(F)(F)F.CCCC(CC)CCC(C)C[Al-](CC(C)CCC(CC)CCC)(CC(C)CCC(CC)CCC)CC(C)CCC(CC)CCC |
| InChI | InChI=1S/C14H16F7P.4C11H23.Al/c1-3-4-9(2)8-22(14(20,21)13(17,18)19)12-7-10(15)5-6-11(12)16;4*1-5-7-11(6-2)9-8-10(3)4;/h5-7,9H,3-4,8H2,1-2H3;4*10-11H,3,5-9H2,1-2,4H3;/q;;;;;-1/p+1 |
| InChIKey | KIWYPDJQXHATLX-UHFFFAOYSA-O |
| XLogP | 21.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 38 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 997.45 |
| LogP ≤ 5 | 21.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|