C50H83AlF11P — CID 22637792
(5-ethyl-2-methyloctyl)-methylphosphanium;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene;tetrakis(2-methylpentyl)alumanuide (PubChem CID 22637792) has the molecular formula C50H83AlF11P and a molecular weight of 951.15 g/mol. Its IUPAC name is (5-ethyl-2-methyloctyl)-methylphosphanium;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene;tetrakis(2-methylpentyl)alumanuide.
| Compound Name | (5-ethyl-2-methyloctyl)-methylphosphanium;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene;tetrakis(2-methylpentyl)alumanuide |
|---|---|
| PubChem CID | 22637792 |
| Molecular Formula | C50H83AlF11P |
| Molecular Weight | 951.15 g/mol |
| Exact Mass | 950.59 |
| IUPAC Name | (5-ethyl-2-methyloctyl)-methylphosphanium;1,2,3,4,5-pentafluoro-6-[3,4,5-trifluoro-2-methyl-6-(trifluoromethyl)phenyl]benzene;tetrakis(2-methylpentyl)alumanuide |
| SMILES | CCCC(C)C[Al-](CC(C)CCC)(CC(C)CCC)CC(C)CCC.CCCC(CC)CCC(C)C[PH2+]C.Cc1c(F)c(F)c(F)c(C(F)(F)F)c1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H3F11.C12H27P.4C6H13.Al/c1-2-3(4-7(16)11(20)13(22)12(21)8(4)17)5(14(23,24)25)9(18)10(19)6(2)15;1-5-7-12(6-2)9-8-11(3)10-13-4;4*1-4-5-6(2)3;/h1H3;11-13H,5-10H2,1-4H3;4*6H,2,4-5H2,1,3H3;/q;;;;;;-1/p+1 |
| InChIKey | NGUHFXBKVIYDNG-UHFFFAOYSA-O |
| XLogP | 19.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.15 |
| LogP ≤ 5 | 19.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|