C48H84AlF6N — CID 22637971
bis(2-methylpentyl)azanium;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene;tetrakis(2-methylpentyl)alumanuide (PubChem CID 22637971) has the molecular formula C48H84AlF6N and a molecular weight of 816.18 g/mol. Its IUPAC name is bis(2-methylpentyl)azanium;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene;tetrakis(2-methylpentyl)alumanuide.
| Compound Name | bis(2-methylpentyl)azanium;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene;tetrakis(2-methylpentyl)alumanuide |
|---|---|
| PubChem CID | 22637971 |
| Molecular Formula | C48H84AlF6N |
| Molecular Weight | 816.18 g/mol |
| Exact Mass | 815.63 |
| IUPAC Name | bis(2-methylpentyl)azanium;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene;tetrakis(2-methylpentyl)alumanuide |
| SMILES | CCCC(C)C[Al-](CC(C)CCC)(CC(C)CCC)CC(C)CCC.CCCC(C)C[NH2+]CC(C)CCC.Fc1ccccc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H4F6.C12H27N.4C6H13.Al/c13-6-4-2-1-3-5(6)7-8(14)10(16)12(18)11(17)9(7)15;1-5-7-11(3)9-13-10-12(4)8-6-2;4*1-4-5-6(2)3;/h1-4H;11-13H,5-10H2,1-4H3;4*6H,2,4-5H2,1,3H3;/q;;;;;;-1/p+1 |
| InChIKey | RLJAYJVSVNNFDP-UHFFFAOYSA-O |
| XLogP | 15.79 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 25 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.18 |
| LogP ≤ 5 | 15.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|