C17H16F7P — CID 87882891
butyl(fluoromethyl)phosphane;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene (PubChem CID 87882891) has the molecular formula C17H16F7P and a molecular weight of 384.28 g/mol. Its IUPAC name is butyl(fluoromethyl)phosphane;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene.
| Compound Name | butyl(fluoromethyl)phosphane;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene |
|---|---|
| PubChem CID | 87882891 |
| Molecular Formula | C17H16F7P |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | butyl(fluoromethyl)phosphane;1,2,3,4,5-pentafluoro-6-(2-fluorophenyl)benzene |
| SMILES | CCCCPCF.Fc1ccccc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H4F6.C5H12FP/c13-6-4-2-1-3-5(6)7-8(14)10(16)12(18)11(17)9(7)15;1-2-3-4-7-5-6/h1-4H;7H,2-5H2,1H3 |
| InChIKey | JMCFQVUUTLLTEK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|