About 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine
4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine (PubChem CID 141297487) has the molecular formula C12H9F3N2
and a molecular weight of 238.21 g/mol. Its IUPAC name is 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine |
| PubChem CID | 141297487 |
| Molecular Formula | C12H9F3N2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)c(F)c(-c2ccccc2F)c1F |
| InChI | InChI=1S/C12H9F3N2/c13-7-4-2-1-3-6(7)10-11(14)8(16)5-9(17)12(10)15/h1-5H,16-17H2 |
| InChIKey | KAFGMSBIVVGXHY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine?
The IUPAC name of 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine (CID 141297487) is 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine.
What is the SMILES notation for 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine?
The canonical SMILES for 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine is Nc1cc(N)c(F)c(-c2ccccc2F)c1F.
What is the InChIKey of 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine?
The InChIKey is KAFGMSBIVVGXHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F3N2/c13-7-4-2-1-3-6(7)10-11(14)8(16)5-9(17)12(10)15/h1-5H,16-17H2.
What are the key properties of 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine?
4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine has a molecular weight of 238.21 g/mol, XLogP of 2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine is sourced from PubChem (CID 141297487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).