C12H9F3N2 — CID 141297487
4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine (PubChem CID 141297487) has the molecular formula C12H9F3N2 and a molecular weight of 238.21 g/mol. Its IUPAC name is 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine.
| Compound Name | 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 141297487 |
| Molecular Formula | C12H9F3N2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 4,6-difluoro-5-(2-fluorophenyl)benzene-1,3-diamine |
| SMILES | Nc1cc(N)c(F)c(-c2ccccc2F)c1F |
| InChI | InChI=1S/C12H9F3N2/c13-7-4-2-1-3-6(7)10-11(14)8(16)5-9(17)12(10)15/h1-5H,16-17H2 |
| InChIKey | KAFGMSBIVVGXHY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|