C45H76AlF8P — CID 22638316
2-methylpentyl(propyl)phosphanium;1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;tetrakis(2-methylpentyl)alumanuide (PubChem CID 22638316) has the molecular formula C45H76AlF8P and a molecular weight of 827.04 g/mol. Its IUPAC name is 2-methylpentyl(propyl)phosphanium;1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;tetrakis(2-methylpentyl)alumanuide.
| Compound Name | 2-methylpentyl(propyl)phosphanium;1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;tetrakis(2-methylpentyl)alumanuide |
|---|---|
| PubChem CID | 22638316 |
| Molecular Formula | C45H76AlF8P |
| Molecular Weight | 827.04 g/mol |
| Exact Mass | 826.54 |
| IUPAC Name | 2-methylpentyl(propyl)phosphanium;1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;tetrakis(2-methylpentyl)alumanuide |
| SMILES | CCCC(C)C[Al-](CC(C)CCC)(CC(C)CCC)CC(C)CCC.CCC[PH2+]CC(C)CCC.Fc1ccc(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12H2F8.C9H21P.4C6H13.Al/c13-4-2-1-3(6(14)7(4)15)5-8(16)10(18)12(20)11(19)9(5)17;1-4-6-9(3)8-10-7-5-2;4*1-4-5-6(2)3;/h1-2H;9-10H,4-8H2,1-3H3;4*6H,2,4-5H2,1,3H3;/q;;;;;;-1/p+1 |
| InChIKey | UVDQTSNZMULJGQ-UHFFFAOYSA-O |
| XLogP | 16.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 23 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.04 |
| LogP ≤ 5 | 16.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|