C18H17F8N — CID 160588868
1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;N-propylpropan-1-amine (PubChem CID 160588868) has the molecular formula C18H17F8N and a molecular weight of 399.33 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;N-propylpropan-1-amine.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;N-propylpropan-1-amine |
|---|---|
| PubChem CID | 160588868 |
| Molecular Formula | C18H17F8N |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(2,3,4-trifluorophenyl)benzene;N-propylpropan-1-amine |
| SMILES | CCCNCCC.Fc1ccc(-c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12H2F8.C6H15N/c13-4-2-1-3(6(14)7(4)15)5-8(16)10(18)12(20)11(19)9(5)17;1-3-5-7-6-4-2/h1-2H;7H,3-6H2,1-2H3 |
| InChIKey | RCTBPICATKNCEG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|