C12H3F7 — CID 164665926
1,2,4,5-tetrafluoro-3-(2,3,4-trifluorophenyl)benzene (PubChem CID 164665926) has the molecular formula C12H3F7 and a molecular weight of 280.14 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-(2,3,4-trifluorophenyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-(2,3,4-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 164665926 |
| Molecular Formula | C12H3F7 |
| Molecular Weight | 280.14 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-(2,3,4-trifluorophenyl)benzene |
| SMILES | Fc1ccc(-c2c(F)c(F)cc(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12H3F7/c13-5-2-1-4(9(16)12(5)19)8-10(17)6(14)3-7(15)11(8)18/h1-3H |
| InChIKey | PRSVWMKGTDETMF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.14 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|