C9H4F3N3 — CID 175245478
2-(2,3,4-trifluorophenyl)-1,3,5-triazine (PubChem CID 175245478) has the molecular formula C9H4F3N3 and a molecular weight of 211.15 g/mol. Its IUPAC name is 2-(2,3,4-trifluorophenyl)-1,3,5-triazine.
| Compound Name | 2-(2,3,4-trifluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 175245478 |
| Molecular Formula | C9H4F3N3 |
| Molecular Weight | 211.15 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2-(2,3,4-trifluorophenyl)-1,3,5-triazine |
| SMILES | Fc1ccc(-c2ncncn2)c(F)c1F |
| InChI | InChI=1S/C9H4F3N3/c10-6-2-1-5(7(11)8(6)12)9-14-3-13-4-15-9/h1-4H |
| InChIKey | VKRYOWKGWKVDAA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|