C14H6ClF3N2 — CID 79749850
4-chloro-2-(2,3,4-trifluorophenyl)quinazoline (PubChem CID 79749850) has the molecular formula C14H6ClF3N2 and a molecular weight of 294.66 g/mol. Its IUPAC name is 4-chloro-2-(2,3,4-trifluorophenyl)quinazoline.
| Compound Name | 4-chloro-2-(2,3,4-trifluorophenyl)quinazoline |
|---|---|
| PubChem CID | 79749850 |
| Molecular Formula | C14H6ClF3N2 |
| Molecular Weight | 294.66 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 4-chloro-2-(2,3,4-trifluorophenyl)quinazoline |
| SMILES | Fc1ccc(-c2nc(Cl)c3ccccc3n2)c(F)c1F |
| InChI | InChI=1S/C14H6ClF3N2/c15-13-7-3-1-2-4-10(7)19-14(20-13)8-5-6-9(16)12(18)11(8)17/h1-6H |
| InChIKey | XXVGRYMBZPSAMS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|