C16H13F2N3 — CID 59213691
2-(2,3-difluorophenyl)-N,N-dimethylquinazolin-4-amine (PubChem CID 59213691) has the molecular formula C16H13F2N3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-N,N-dimethylquinazolin-4-amine.
| Compound Name | 2-(2,3-difluorophenyl)-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 59213691 |
| Molecular Formula | C16H13F2N3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(2,3-difluorophenyl)-N,N-dimethylquinazolin-4-amine |
| SMILES | CN(C)c1nc(-c2cccc(F)c2F)nc2ccccc12 |
| InChI | InChI=1S/C16H13F2N3/c1-21(2)16-10-6-3-4-9-13(10)19-15(20-16)11-7-5-8-12(17)14(11)18/h3-9H,1-2H3 |
| InChIKey | WJIDWHUPLDXKKU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |