C15H9F2N — CID 167880208
5-(2,3-difluorophenyl)quinoline (PubChem CID 167880208) has the molecular formula C15H9F2N and a molecular weight of 241.24 g/mol. Its IUPAC name is 5-(2,3-difluorophenyl)quinoline.
| Compound Name | 5-(2,3-difluorophenyl)quinoline |
|---|---|
| PubChem CID | 167880208 |
| Molecular Formula | C15H9F2N |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 5-(2,3-difluorophenyl)quinoline |
| SMILES | Fc1cccc(-c2cccc3ncccc23)c1F |
| InChI | InChI=1S/C15H9F2N/c16-13-7-1-5-12(15(13)17)10-4-2-8-14-11(10)6-3-9-18-14/h1-9H |
| InChIKey | AESCOYHLAGEMBL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |