C19H14F3N3 — CID 174919283
pyrimidine;quinoline;1,2,3-trifluorobenzene (PubChem CID 174919283) has the molecular formula C19H14F3N3 and a molecular weight of 341.34 g/mol. Its IUPAC name is pyrimidine;quinoline;1,2,3-trifluorobenzene.
| Compound Name | pyrimidine;quinoline;1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 174919283 |
| Molecular Formula | C19H14F3N3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | pyrimidine;quinoline;1,2,3-trifluorobenzene |
| SMILES | Fc1cccc(F)c1F.c1ccc2ncccc2c1.c1cncnc1 |
| InChI | InChI=1S/C9H7N.C6H3F3.C4H4N2/c1-2-6-9-8(4-1)5-3-7-10-9;7-4-2-1-3-5(8)6(4)9;1-2-5-4-6-3-1/h1-7H;1-3H;1-4H |
| InChIKey | XZRJAAFPTQVQSM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|