C20H24N4 — CID 130369805
2-[4-(diethylamino)phenyl]-N,N-dimethylquinazolin-4-amine (PubChem CID 130369805) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-[4-(diethylamino)phenyl]-N,N-dimethylquinazolin-4-amine.
| Compound Name | 2-[4-(diethylamino)phenyl]-N,N-dimethylquinazolin-4-amine |
|---|---|
| PubChem CID | 130369805 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-[4-(diethylamino)phenyl]-N,N-dimethylquinazolin-4-amine |
| SMILES | CCN(CC)c1ccc(-c2nc(N(C)C)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C20H24N4/c1-5-24(6-2)16-13-11-15(12-14-16)19-21-18-10-8-7-9-17(18)20(22-19)23(3)4/h7-14H,5-6H2,1-4H3 |
| InChIKey | QRYZCIJUWZJIBR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |