C11H7F3N2 — CID 104877319
4-(2,3,4-trifluorophenyl)pyridin-2-amine (PubChem CID 104877319) has the molecular formula C11H7F3N2 and a molecular weight of 224.19 g/mol. Its IUPAC name is 4-(2,3,4-trifluorophenyl)pyridin-2-amine.
| Compound Name | 4-(2,3,4-trifluorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 104877319 |
| Molecular Formula | C11H7F3N2 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 4-(2,3,4-trifluorophenyl)pyridin-2-amine |
| SMILES | Nc1cc(-c2ccc(F)c(F)c2F)ccn1 |
| InChI | InChI=1S/C11H7F3N2/c12-8-2-1-7(10(13)11(8)14)6-3-4-16-9(15)5-6/h1-5H,(H2,15,16) |
| InChIKey | ADSFBXRKYNPULX-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|