C13H9F3N2O — CID 114017886
2-(2-amino-4-pyridinyl)-1-(2,3,4-trifluorophenyl)ethanone (PubChem CID 114017886) has the molecular formula C13H9F3N2O and a molecular weight of 266.22 g/mol. Its IUPAC name is 2-(2-amino-4-pyridinyl)-1-(2,3,4-trifluorophenyl)ethanone.
| Compound Name | 2-(2-amino-4-pyridinyl)-1-(2,3,4-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 114017886 |
| Molecular Formula | C13H9F3N2O |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(2-amino-4-pyridinyl)-1-(2,3,4-trifluorophenyl)ethanone |
| SMILES | Nc1cc(CC(=O)c2ccc(F)c(F)c2F)ccn1 |
| InChI | InChI=1S/C13H9F3N2O/c14-9-2-1-8(12(15)13(9)16)10(19)5-7-3-4-18-11(17)6-7/h1-4,6H,5H2,(H2,17,18) |
| InChIKey | ARBUJQFVEYVHSN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|