C10H14N2O3 — CID 79492824
3-(2-amino-4-pyridinyl)-1,1-dimethoxypropan-2-one (PubChem CID 79492824) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-(2-amino-4-pyridinyl)-1,1-dimethoxypropan-2-one.
| Compound Name | 3-(2-amino-4-pyridinyl)-1,1-dimethoxypropan-2-one |
|---|---|
| PubChem CID | 79492824 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-(2-amino-4-pyridinyl)-1,1-dimethoxypropan-2-one |
| SMILES | COC(OC)C(=O)Cc1ccnc(N)c1 |
| InChI | InChI=1S/C10H14N2O3/c1-14-10(15-2)8(13)5-7-3-4-12-9(11)6-7/h3-4,6,10H,5H2,1-2H3,(H2,11,12) |
| InChIKey | VSZTVZOYMKIMJP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|