C10H16N2O3 — CID 171796381
4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine (PubChem CID 171796381) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine.
| Compound Name | 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 171796381 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine |
| SMILES | COC(COCc1ccnc(N)c1)OC |
| InChI | InChI=1S/C10H16N2O3/c1-13-10(14-2)7-15-6-8-3-4-12-9(11)5-8/h3-5,10H,6-7H2,1-2H3,(H2,11,12) |
| InChIKey | ONZYYWJFGLUBJJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|