About 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine
4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine (PubChem CID 171796381) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine |
| PubChem CID | 171796381 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine |
| SMILES | COC(COCc1ccnc(N)c1)OC |
| InChI | InChI=1S/C10H16N2O3/c1-13-10(14-2)7-15-6-8-3-4-12-9(11)5-8/h3-5,10H,6-7H2,1-2H3,(H2,11,12) |
| InChIKey | ONZYYWJFGLUBJJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine?
The IUPAC name of 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine (CID 171796381) is 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine.
What is the SMILES notation for 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine?
The canonical SMILES for 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine is COC(COCc1ccnc(N)c1)OC.
What is the InChIKey of 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine?
The InChIKey is ONZYYWJFGLUBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-13-10(14-2)7-15-6-8-3-4-12-9(11)5-8/h3-5,10H,6-7H2,1-2H3,(H2,11,12).
What are the key properties of 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine?
4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine has a molecular weight of 212.25 g/mol, XLogP of 0.80, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethoxyethoxymethyl)pyridin-2-amine is sourced from PubChem (CID 171796381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).