C16H13F3O — CID 62963933
2-(3,4-dimethylphenyl)-1-(2,3,4-trifluorophenyl)ethanone (PubChem CID 62963933) has the molecular formula C16H13F3O and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-1-(2,3,4-trifluorophenyl)ethanone.
| Compound Name | 2-(3,4-dimethylphenyl)-1-(2,3,4-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 62963933 |
| Molecular Formula | C16H13F3O |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-1-(2,3,4-trifluorophenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)c2ccc(F)c(F)c2F)cc1C |
| InChI | InChI=1S/C16H13F3O/c1-9-3-4-11(7-10(9)2)8-14(20)12-5-6-13(17)16(19)15(12)18/h3-7H,8H2,1-2H3 |
| InChIKey | MSPCWAKSECSWAO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|