C16H14ClFO — CID 64714143
1-(3-chloro-2-fluorophenyl)-2-(3,4-dimethylphenyl)ethanone (PubChem CID 64714143) has the molecular formula C16H14ClFO and a molecular weight of 276.74 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-2-(3,4-dimethylphenyl)ethanone.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-2-(3,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 64714143 |
| Molecular Formula | C16H14ClFO |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-2-(3,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)c2cccc(Cl)c2F)cc1C |
| InChI | InChI=1S/C16H14ClFO/c1-10-6-7-12(8-11(10)2)9-15(19)13-4-3-5-14(17)16(13)18/h3-8H,9H2,1-2H3 |
| InChIKey | ZTJBUTIHSMEYPJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |