C12H10FN3O — CID 79722239
2-(2-amino-4-pyridinyl)-1-(5-fluoro-2-pyridinyl)ethanone (PubChem CID 79722239) has the molecular formula C12H10FN3O and a molecular weight of 231.23 g/mol. Its IUPAC name is 2-(2-amino-4-pyridinyl)-1-(5-fluoro-2-pyridinyl)ethanone.
| Compound Name | 2-(2-amino-4-pyridinyl)-1-(5-fluoro-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 79722239 |
| Molecular Formula | C12H10FN3O |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 2-(2-amino-4-pyridinyl)-1-(5-fluoro-2-pyridinyl)ethanone |
| SMILES | Nc1cc(CC(=O)c2ccc(F)cn2)ccn1 |
| InChI | InChI=1S/C12H10FN3O/c13-9-1-2-10(16-7-9)11(17)5-8-3-4-15-12(14)6-8/h1-4,6-7H,5H2,(H2,14,15) |
| InChIKey | DRBUJXCXLPETRU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |