C23H19F3N2O3 — CID 158154885
2-(3-acetyl-4-fluorophenyl)-1-(5-fluoro-2-pyridinyl)ethanone;1-(5-amino-2-fluorophenyl)ethanone (PubChem CID 158154885) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is 2-(3-acetyl-4-fluorophenyl)-1-(5-fluoro-2-pyridinyl)ethanone;1-(5-amino-2-fluorophenyl)ethanone.
| Compound Name | 2-(3-acetyl-4-fluorophenyl)-1-(5-fluoro-2-pyridinyl)ethanone;1-(5-amino-2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 158154885 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-(3-acetyl-4-fluorophenyl)-1-(5-fluoro-2-pyridinyl)ethanone;1-(5-amino-2-fluorophenyl)ethanone |
| SMILES | CC(=O)c1cc(CC(=O)c2ccc(F)cn2)ccc1F.CC(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C15H11F2NO2.C8H8FNO/c1-9(19)12-6-10(2-4-13(12)17)7-15(20)14-5-3-11(16)8-18-14;1-5(11)7-4-6(10)2-3-8(7)9/h2-6,8H,7H2,1H3;2-4H,10H2,1H3 |
| InChIKey | FVOCQGBCOFXUBE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|