C13H12BrN3O — CID 116597144
1-(3-amino-5-bromophenyl)-2-(2-amino-4-pyridinyl)ethanone (PubChem CID 116597144) has the molecular formula C13H12BrN3O and a molecular weight of 306.16 g/mol. Its IUPAC name is 1-(3-amino-5-bromophenyl)-2-(2-amino-4-pyridinyl)ethanone.
| Compound Name | 1-(3-amino-5-bromophenyl)-2-(2-amino-4-pyridinyl)ethanone |
|---|---|
| PubChem CID | 116597144 |
| Molecular Formula | C13H12BrN3O |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 1-(3-amino-5-bromophenyl)-2-(2-amino-4-pyridinyl)ethanone |
| SMILES | Nc1cc(Br)cc(C(=O)Cc2ccnc(N)c2)c1 |
| InChI | InChI=1S/C13H12BrN3O/c14-10-5-9(6-11(15)7-10)12(18)3-8-1-2-17-13(16)4-8/h1-2,4-7H,3,15H2,(H2,16,17) |
| InChIKey | GWBNDSWQOLVSJW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|