C13H10F3N3 — CID 81223655
4-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine (PubChem CID 81223655) has the molecular formula C13H10F3N3 and a molecular weight of 265.24 g/mol. Its IUPAC name is 4-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine.
| Compound Name | 4-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 81223655 |
| Molecular Formula | C13H10F3N3 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 4-(2,3,4-trifluorophenyl)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine |
| SMILES | Fc1ccc(-c2ncnc3c2CNCC3)c(F)c1F |
| InChI | InChI=1S/C13H10F3N3/c14-9-2-1-7(11(15)12(9)16)13-8-5-17-4-3-10(8)18-6-19-13/h1-2,6,17H,3-5H2 |
| InChIKey | IWMOEVWMHMHLAV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|