C12H5F5 — CID 90766512
1-(2,4-difluorophenyl)-2,3,4-trifluorobenzene (PubChem CID 90766512) has the molecular formula C12H5F5 and a molecular weight of 244.16 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2,3,4-trifluorobenzene.
| Compound Name | 1-(2,4-difluorophenyl)-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 90766512 |
| Molecular Formula | C12H5F5 |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2,3,4-trifluorobenzene |
| SMILES | Fc1ccc(-c2ccc(F)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C12H5F5/c13-6-1-2-7(10(15)5-6)8-3-4-9(14)12(17)11(8)16/h1-5H |
| InChIKey | BVBQKKRRVVJZMT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|