C12H8F3N — CID 57415152
4-(2,4-difluorophenyl)-3-fluoroaniline (PubChem CID 57415152) has the molecular formula C12H8F3N and a molecular weight of 223.20 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-3-fluoroaniline.
| Compound Name | 4-(2,4-difluorophenyl)-3-fluoroaniline |
|---|---|
| PubChem CID | 57415152 |
| Molecular Formula | C12H8F3N |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-(2,4-difluorophenyl)-3-fluoroaniline |
| SMILES | Nc1ccc(-c2ccc(F)cc2F)c(F)c1 |
| InChI | InChI=1S/C12H8F3N/c13-7-1-3-9(11(14)5-7)10-4-2-8(16)6-12(10)15/h1-6H,16H2 |
| InChIKey | FAZSCYDKCVDHRE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|